|
CAS#: 38327-45-6 Product: (2S)-2-Amino-3-(2-Sulfanyl-1H-Indol-3-Yl)Propanoic Acid No suppilers available for the product. |
| Name | (2S)-2-Amino-3-(2-Sulfanyl-1H-Indol-3-Yl)Propanoic Acid |
|---|---|
| Synonyms | (2S)-2-Amino-3-(2-Mercapto-1H-Indol-3-Yl)Propanoic Acid; (2S)-2-Amino-3-(2-Mercapto-1H-Indol-3-Yl)Propionic Acid; L-Tryptophan, 2-Mercapto- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.29 |
| CAS Registry Number | 38327-45-6 |
| SMILES | [C@H](C(=O)O)(N)CC1=C([NH]C2=CC=CC=C12)S |
| InChI | 1S/C11H12N2O2S/c12-8(11(14)15)5-7-6-3-1-2-4-9(6)13-10(7)16/h1-4,8,13,16H,5,12H2,(H,14,15)/t8-/m0/s1 |
| InChIKey | UDCPMOBROGCQJP-QMMMGPOBSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 510.433°C at 760 mmHg (Cal.) |
| Flash point | 262.501°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2S)-2-Amino-3-(2-Sulfanyl-1H-Indol-3-Yl)Propanoic Acid |