|
CAS#: 38399-72-3 Product: 9,10-Dihydroanthracene-1,4,9,10-Tetrol No suppilers available for the product. |
| Name | 9,10-Dihydroanthracene-1,4,9,10-Tetrol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 |
| CAS Registry Number | 38399-72-3 |
| EINECS | 253-912-8 |
| SMILES | C3=C(O)C1=C(C(O)C2=C(C1O)C=CC=C2)C(=C3)O |
| InChI | 1S/C14H12O4/c15-9-5-6-10(16)12-11(9)13(17)7-3-1-2-4-8(7)14(12)18/h1-6,13-18H |
| InChIKey | ZIKKFAGENVKXRO-UHFFFAOYSA-N |
| Density | 1.557g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.652°C at 760 mmHg (Cal.) |
| Flash point | 203.921°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydroanthracene-1,4,9,10-Tetrol |