|
CAS#: 38452-40-3 Product: 1,2-Dimethoxy-4-Methyl-5-Methylsulfonylbenzene No suppilers available for the product. |
| Name | 1,2-Dimethoxy-4-Methyl-5-Methylsulfonylbenzene |
|---|---|
| Synonyms | 1,2-Dimethoxy-4-Methyl-5-Methylsulfonyl-Benzene; 1-Mesyl-4,5-Dimethoxy-2-Methyl-Benzene; Benzene, 1,2-Dimethoxy-4-Methyl-5-(Methylsulfonyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 |
| CAS Registry Number | 38452-40-3 |
| SMILES | C1=C(C(=CC(=C1C)[S](=O)(=O)C)OC)OC |
| InChI | 1S/C10H14O4S/c1-7-5-8(13-2)9(14-3)6-10(7)15(4,11)12/h5-6H,1-4H3 |
| InChIKey | BDSQTUZWUIXSNF-UHFFFAOYSA-N |
| Density | 1.178g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.336°C at 760 mmHg (Cal.) |
| Flash point | 189.264°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dimethoxy-4-Methyl-5-Methylsulfonylbenzene |