|
CAS#: 3846-49-9 Product: 1,3-Diethyl-1,3-Bis(4-Nitrophenyl)Urea No suppilers available for the product. |
| Name | 1,3-Diethyl-1,3-Bis(4-Nitrophenyl)Urea |
|---|---|
| Synonyms | Ai3-27440; Urea, N,N'-Diethyl-N,N'-Bis(4-Nitrophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18N4O5 |
| Molecular Weight | 358.35 |
| CAS Registry Number | 3846-49-9 |
| EINECS | 223-344-5 |
| SMILES | C1=C([N+]([O-])=O)C=CC(=C1)N(C(N(C2=CC=C([N+]([O-])=O)C=C2)CC)=O)CC |
| InChI | 1S/C17H18N4O5/c1-3-18(13-5-9-15(10-6-13)20(23)24)17(22)19(4-2)14-7-11-16(12-8-14)21(25)26/h5-12H,3-4H2,1-2H3 |
| InChIKey | PJTRUXHYQYQMTG-UHFFFAOYSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.213°C at 760 mmHg (Cal.) |
| Flash point | 274.463°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Diethyl-1,3-Bis(4-Nitrophenyl)Urea |