|
CAS#: 3862-11-1 Product: Tris(3,4-Dimethylphenyl) Phosphate No suppilers available for the product. |
| Name | Tris(3,4-Dimethylphenyl) Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Tris(3,4-Dimethylphenyl) Ester; 3,4-Xylenol, Phosphate (3:1); Hsdb 3911 |
| Molecular Structure | ![]() |
| Molecular Formula | C24H27O4P |
| Molecular Weight | 410.45 |
| CAS Registry Number | 3862-11-1 |
| SMILES | C3=C(O[P](OC1=CC(=C(C)C=C1)C)(OC2=CC(=C(C)C=C2)C)=O)C=CC(=C3C)C |
| InChI | 1S/C24H27O4P/c1-16-7-10-22(13-19(16)4)26-29(25,27-23-11-8-17(2)20(5)14-23)28-24-12-9-18(3)21(6)15-24/h7-15H,1-6H3 |
| InChIKey | BCTKCHOESSAGCN-UHFFFAOYSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 496.47°C at 760 mmHg (Cal.) |
| Flash point | 267.184°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tris(3,4-Dimethylphenyl) Phosphate |