|
CAS#: 38731-70-3 Product: Sodium 2-Chloro-4-Nitrophenolate No suppilers available for the product. |
| Name | Sodium 2-Chloro-4-Nitrophenolate |
|---|---|
| Synonyms | Sodium 2-Chloro-4-Nitro-Phenolate; 2-Chloro-4-Nitrophenol Sodium; Phenol, 2-Chloro-4-Nitro-, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H3ClNNaO3 |
| Molecular Weight | 195.54 |
| CAS Registry Number | 38731-70-3 |
| SMILES | C1=C(Cl)C(=CC=C1[N+]([O-])=O)[O-].[Na+] |
| InChI | 1S/C6H4ClNO3.Na/c7-5-3-4(8(10)11)1-2-6(5)9;/h1-3,9H;/q;+1/p-1 |
| InChIKey | JPGAEESFKQGCDO-UHFFFAOYSA-M |
| Boiling point | 290.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 129.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2-Chloro-4-Nitrophenolate |