|
CAS#: 3882-38-0 Product: 17-Methylmorphinan No suppilers available for the product. |
| Name | 17-Methylmorphinan |
|---|---|
| Synonyms | C11788; N-Methyl Morphinan; 2H-10,4A-Iminoethanophenanthrene, 1,3,4,9,10,10A-Hexahydro-11-Methyl- (6Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 |
| CAS Registry Number | 3882-38-0 |
| EINECS | 223-412-4 |
| SMILES | [C@]124[C@H]([C@H](N(CC1)C)CC3=C2C=CC=C3)CCCC4 |
| InChI | 1S/C17H23N/c1-18-11-10-17-9-5-4-8-15(17)16(18)12-13-6-2-3-7-14(13)17/h2-3,6-7,15-16H,4-5,8-12H2,1H3/t15-,16+,17-/m0/s1 |
| InChIKey | IHBSVVZENGBQDY-BBWFWOEESA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.149°C at 760 mmHg (Cal.) |
| Flash point | 152.295°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17-Methylmorphinan |