|
CAS#: 38920-83-1 Product: 3-(2-Cyclohexylbutyl)-1,3-Thiazolidine Hydrochloride No suppilers available for the product. |
| Name | 3-(2-Cyclohexylbutyl)-1,3-Thiazolidine Hydrochloride |
|---|---|
| Synonyms | Thiazolidine, 3-(2-Cyclohexylbutyl)-, Hydrochloride; 3-(2-Cyclohexylbutyl)Thiazolidine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C13H26ClNS |
| Molecular Weight | 263.87 |
| CAS Registry Number | 38920-83-1 |
| SMILES | [H+].C(N1CSCC1)C(C2CCCCC2)CC.[Cl-] |
| InChI | 1S/C13H25NS.ClH/c1-2-12(10-14-8-9-15-11-14)13-6-4-3-5-7-13;/h12-13H,2-11H2,1H3;1H |
| InChIKey | BNBLWIGLBOIXDW-UHFFFAOYSA-N |
| Boiling point | 319.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 146.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Cyclohexylbutyl)-1,3-Thiazolidine Hydrochloride |