|
CAS#: 38990-54-4 Product: alpha-(Aminomethyl)-9,10-Ethanoanthracene-9(10H)-Ethanol No suppilers available for the product. |
| Name | alpha-(Aminomethyl)-9,10-Ethanoanthracene-9(10H)-Ethanol |
|---|---|
| Synonyms | Demethyllevoprotiline; Desmethyllevoprotiline |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 |
| CAS Registry Number | 38990-54-4 |
| SMILES | C2=C1C3(C4=C(C(C1=CC=C2)CC3)C=CC=C4)CC(O)CN |
| InChI | 1S/C19H21NO/c20-12-13(21)11-19-10-9-14(15-5-1-3-7-17(15)19)16-6-2-4-8-18(16)19/h1-8,13-14,21H,9-12,20H2 |
| InChIKey | MFFVUOWODXJKPA-UHFFFAOYSA-N |
| Density | 1.199g/cm3 (Cal.) |
|---|---|
| Boiling point | 470.523°C at 760 mmHg (Cal.) |
| Flash point | 238.364°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-(Aminomethyl)-9,10-Ethanoanthracene-9(10H)-Ethanol |