Online Database of Chemicals from Around the World
|
CAS#: 3905-92-8 Product: 3-Amino-4-(2-Amino-4-Sulfamoylphenyl)Disulfanylbenzenesulfonamide No suppilers available for the product. |
| Name | 3-Amino-4-(2-Amino-4-Sulfamoylphenyl)Disulfanylbenzenesulfonamide |
|---|---|
| Synonyms | 3-Amino-4-(2-Amino-4-Sulfamoyl-Phenyl)Disulfanyl-Benzenesulfonamide; Nsc 83217; Nci83217 |
| Molecular Structure |  |
| Molecular Formula | C12H14N4O4S4 |
| Molecular Weight | 406.51 |
| CAS Registry Number | 3905-92-8 |
| SMILES | C1=C([S](=O)(=O)N)C=CC(=C1N)SSC2=C(N)C=C([S](=O)(=O)N)C=C2 |
| InChI | 1S/C12H14N4O4S4/c13-9-5-7(23(15,17)18)1-3-11(9)21-22-12-4-2-8(6-10(12)14)24(16,19)20/h1-6H,13-14H2,(H2,15,17,18)(H2,16,19,20) |
| InChIKey | CVACEDCBGCMVKB-UHFFFAOYSA-N |
| Density | 1.766g/cm3 (Cal.) |
|---|---|
| Boiling point | 700.711°C at 760 mmHg (Cal.) |
| Flash point | 377.576°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Amino-4-(2-Amino-4-Sulfamoylphenyl)Disulfanylbenzenesulfonamide |