|
CAS#: 39209-26-2 Product: N-[(2-Nitrophenyl)Amino]Ethanimidoyl Chloride No suppilers available for the product. |
| Name | N-[(2-Nitrophenyl)Amino]Ethanimidoyl Chloride |
|---|---|
| Synonyms | N-[(2-Nitrophenyl)Amino]Acetimidoyl Chloride; Brn 1842282; Ethanehydrazonoyl Chloride, N-(2-Nitrophenyl)- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8ClN3O2 |
| Molecular Weight | 213.62 |
| CAS Registry Number | 39209-26-2 |
| SMILES | C1=C([N+]([O-])=O)C(=CC=C1)N\N=C(Cl)\C |
| InChI | 1S/C8H8ClN3O2/c1-6(9)10-11-7-4-2-3-5-8(7)12(13)14/h2-5,11H,1H3/b10-6- |
| InChIKey | LOGCSEYHBGGUPQ-POHAHGRESA-N |
| Density | 1.369g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.766°C at 760 mmHg (Cal.) |
| Flash point | 147.794°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(2-Nitrophenyl)Amino]Ethanimidoyl Chloride |