|
CAS#: 3934-76-7 Product: 4-Phenylbenzene-1,2,3-Triol No suppilers available for the product. |
| Name | 4-Phenylbenzene-1,2,3-Triol |
|---|---|
| Synonyms | 4-Phenylpyrogallol; (1,1'-Biphenyl)-2,3,4-Triol; 2,3,4-Trihydroxybiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 |
| CAS Registry Number | 3934-76-7 |
| EINECS | 223-510-7 |
| SMILES | C1=CC(=C(C(=C1C2=CC=CC=C2)O)O)O |
| InChI | 1S/C12H10O3/c13-10-7-6-9(11(14)12(10)15)8-4-2-1-3-5-8/h1-7,13-15H |
| InChIKey | XRBNDLYHPCVYGC-UHFFFAOYSA-N |
| Density | 1.348g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.88°C at 760 mmHg (Cal.) |
| Flash point | 196.546°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Phenylbenzene-1,2,3-Triol |