Online Database of Chemicals from Around the World
|
CAS#: 3942-71-0 Product: (5-Methyl-2-Propan-2-Ylphenyl) N-Methylcarbamate No suppilers available for the product. |
| Name | (5-Methyl-2-Propan-2-Ylphenyl) N-Methylcarbamate |
|---|---|
| Synonyms | (2-Isopropyl-5-Methyl-Phenyl) N-Methylcarbamate; N-Methylcarbamic Acid (2-Isopropyl-5-Methylphenyl) Ester; N-Methylcarbamic Acid (2-Isopropyl-5-Methyl-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 |
| CAS Registry Number | 3942-71-0 |
| SMILES | C1=C(C)C=CC(=C1OC(NC)=O)C(C)C |
| InChI | 1S/C12H17NO2/c1-8(2)10-6-5-9(3)7-11(10)15-12(14)13-4/h5-8H,1-4H3,(H,13,14) |
| InChIKey | OWKQRPRYKIPYIG-UHFFFAOYSA-N |
| Density | 1.025g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.214°C at 760 mmHg (Cal.) |
| Flash point | 128.108°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (5-Methyl-2-Propan-2-Ylphenyl) N-Methylcarbamate |