|
CAS#: 39484-09-8 Product: (2R)-2-Acetamido-3-(2,5-Dihydroxyphenyl)Sulfanylpropanoic Acid No suppilers available for the product. |
| Name | (2R)-2-Acetamido-3-(2,5-Dihydroxyphenyl)Sulfanylpropanoic Acid |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-(2,5-Dihydroxyphenyl)Sulfanyl-Propanoic Acid; (2R)-2-Acetamido-3-[(2,5-Dihydroxyphenyl)Thio]Propanoic Acid; (2R)-2-Acetamido-3-[(2,5-Dihydroxyphenyl)Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13NO5S |
| Molecular Weight | 271.29 |
| CAS Registry Number | 39484-09-8 |
| SMILES | [C@H](NC(=O)C)(CSC1=CC(=CC=C1O)O)C(=O)O |
| InChI | 1S/C11H13NO5S/c1-6(13)12-8(11(16)17)5-18-10-4-7(14)2-3-9(10)15/h2-4,8,14-15H,5H2,1H3,(H,12,13)(H,16,17)/t8-/m0/s1 |
| InChIKey | MGRMXYTUNZXUAF-QMMMGPOBSA-N |
| Density | 1.504g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.62°C at 760 mmHg (Cal.) |
| Flash point | 317.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R)-2-Acetamido-3-(2,5-Dihydroxyphenyl)Sulfanylpropanoic Acid |