|
CAS#: 39572-10-6 Product: 2-(O-Methoxyphenoxy)Thiazole No suppilers available for the product. |
| Name | 2-(O-Methoxyphenoxy)Thiazole |
|---|---|
| Synonyms | 2-(2-Methoxyphenoxy)Thiazole; 2-(O-Methoxyphenoxy)Thiazole |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO2S |
| Molecular Weight | 207.25 |
| CAS Registry Number | 39572-10-6 |
| EINECS | 254-524-1 |
| SMILES | C1=CN=C(S1)OC2=C(OC)C=CC=C2 |
| InChI | 1S/C10H9NO2S/c1-12-8-4-2-3-5-9(8)13-10-11-6-7-14-10/h2-7H,1H3 |
| InChIKey | HMYOSXCMLRLQFV-UHFFFAOYSA-N |
| Density | 1.243g/cm3 (Cal.) |
|---|---|
| Boiling point | 326.92°C at 760 mmHg (Cal.) |
| Flash point | 151.516°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(O-Methoxyphenoxy)Thiazole |