|
CAS#: 3976-10-1 Product: 4-Phenylmorpholine Hydrochloride No suppilers available for the product. |
| Name | 4-Phenylmorpholine Hydrochloride |
|---|---|
| Synonyms | N-Phenylmorpholine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 |
| CAS Registry Number | 3976-10-1 |
| EINECS | 223-607-4 |
| SMILES | [H+].C2=C(N1CCOCC1)C=CC=C2.[Cl-] |
| InChI | 1S/C10H13NO.ClH/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;/h1-5H,6-9H2;1H |
| InChIKey | OJTANAMJGXNZOK-UHFFFAOYSA-N |
| Boiling point | 264.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 80.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Phenylmorpholine Hydrochloride |