|
CAS#: 3990-01-0 Product: 6-Deoxydihydro-Codeine No suppilers available for the product. |
| Name | 6-Deoxydihydro-Codeine |
|---|---|
| Synonyms | Deoxydihydrocodeine D; Desocodeine; Dihydrodesoxycodeine-D |
| Molecular Structure | ![]() |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 |
| CAS Registry Number | 3990-01-0 |
| SMILES | [C@@H]15CC4=C3[C@@]2([C@H]1CCC[C@@H]2OC3=C(C=C4)OC)CCN5C |
| InChI | 1S/C18H23NO2/c1-19-9-8-18-12-4-3-5-15(18)21-17-14(20-2)7-6-11(16(17)18)10-13(12)19/h6-7,12-13,15H,3-5,8-10H2,1-2H3/t12-,13+,15-,18+/m0/s1 |
| InChIKey | ZJWPQUSUXBOTPF-SCGCMHLBSA-N |
| Density | 1.234g/cm3 (Cal.) |
|---|---|
| Boiling point | 416.174°C at 760 mmHg (Cal.) |
| Flash point | 150.093°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Deoxydihydro-Codeine |