|
CAS#: 40041-96-1 Product: Angustine No suppilers available for the product. |
| Name | Angustine |
|---|---|
| Synonyms | 3,14-Dihydroangustine; Angustine; C09032 |
| Molecular Structure | ![]() |
| Molecular Formula | C20H15N3O |
| Molecular Weight | 313.36 |
| CAS Registry Number | 40041-96-1 |
| SMILES | C1=NC=C2C(=C1C=C)C=C3N(C2=O)CCC4=C3[NH]C5=C4C=CC=C5 |
| InChI | 1S/C20H15N3O/c1-2-12-10-21-11-16-15(12)9-18-19-14(7-8-23(18)20(16)24)13-5-3-4-6-17(13)22-19/h2-6,9-11,22H,1,7-8H2 |
| InChIKey | FACXQEOSOVJIPD-UHFFFAOYSA-N |
| Density | 1.401g/cm3 (Cal.) |
|---|---|
| Boiling point | 648.213°C at 760 mmHg (Cal.) |
| Flash point | 345.827°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Angustine |