|
CAS#: 40088-45-7 Product: 1,2-Dibromo-3-(3,4-Dibromophenyl)Benzene No suppilers available for the product. |
| Name | 1,2-Dibromo-3-(3,4-Dibromophenyl)Benzene |
|---|---|
| Synonyms | Tetrabromo-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Br4 |
| Molecular Weight | 469.80 |
| CAS Registry Number | 40088-45-7 |
| SMILES | C1=C(C(=C(C=C1)C2=CC=C(C(=C2)Br)Br)Br)Br |
| InChI | 1S/C12H6Br4/c13-9-5-4-7(6-11(9)15)8-2-1-3-10(14)12(8)16/h1-6H |
| InChIKey | GEASNODZMCZDOU-UHFFFAOYSA-N |
| Density | 2.141g/cm3 (Cal.) |
|---|---|
| Boiling point | 419.285°C at 760 mmHg (Cal.) |
| Flash point | 200.641°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2-Dibromo-3-(3,4-Dibromophenyl)Benzene |