|
CAS#: 402-35-7 Product: 1-(2-Chloroethyl)-3-(Trifluoromethyl)Benzene No suppilers available for the product. |
| Name | 1-(2-Chloroethyl)-3-(Trifluoromethyl)Benzene |
|---|---|
| Synonyms | Nsc400303 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8ClF3 |
| Molecular Weight | 208.61 |
| CAS Registry Number | 402-35-7 |
| SMILES | C1=C(C(F)(F)F)C=CC=C1CCCl |
| InChI | 1S/C9H8ClF3/c10-5-4-7-2-1-3-8(6-7)9(11,12)13/h1-3,6H,4-5H2 |
| InChIKey | WRCSFUANACAWCW-UHFFFAOYSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 202.985°C at 760 mmHg (Cal.) |
| Flash point | 78.506°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chloroethyl)-3-(Trifluoromethyl)Benzene |