| Name | 1-(4-Nitrophenyl)Butane-1,3-Dione |
|---|---|
| Synonyms | (P-Nitrobenzoyl)Acetone; 1,3-Butanedione, 1-(4-Nitrophenyl)-; 1,3-Butanedione, 1-(P-Nitrophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 |
| CAS Registry Number | 4023-82-9 |
| SMILES | C1=CC(=CC=C1C(CC(C)=O)=O)[N+](=O)[O-] |
| InChI | 1S/C10H9NO4/c1-7(12)6-10(13)8-2-4-9(5-3-8)11(14)15/h2-5H,6H2,1H3 |
| InChIKey | UUFHFNDYTYXICJ-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.785°C at 760 mmHg (Cal.) |
| Flash point | 166.834°C (Cal.) |
| (1) | Federico Berti, Simone Bincoletto, Ivan Donati, Giampaolo Fontanive, Massimo Fregonese and Fabio Benedetti. Albumin-directed stereoselective reduction of 1,3-diketones and β-hydroxyketones to anti diols, Org. Biomol. Chem., 2011, 9, 1987. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(4-Nitrophenyl)Butane-1,3-Dione |