|
CAS#: 40334-70-1 Product: Lewisitel-3 No suppilers available for the product. |
| Name | Lewisitel-3 |
|---|---|
| Synonyms | Tris[(E)-2-Chlorovinyl]Arsane; Arsine, Tris(2-Chloroethenyl)-; Lewisite 3 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6AsCl3 |
| Molecular Weight | 259.39 |
| CAS Registry Number | 40334-70-1 |
| SMILES | Cl/C=C/[As](/C=C/Cl)/C=C/Cl |
| InChI | 1S/C6H6AsCl3/c8-4-1-7(2-5-9)3-6-10/h1-6H/b4-1+,5-2+,6-3+ |
| InChIKey | AOAVIJUEFJPSAI-GZDDRBCLSA-N |
| Boiling point | 215.392°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 129.024°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lewisitel-3 |