|
CAS#: 4037-12-1 Product: (1,2-Butadienyl-3-Methyl)-Phosphonic Acid Dimethyl Ester No suppilers available for the product. |
| Name | (1,2-Butadienyl-3-Methyl)-Phosphonic Acid Dimethyl Ester |
|---|---|
| Synonyms | 1-Dimethoxyphosphoryl-3-Methyl-Buta-1,2-Diene; (Methoxy-(3-Methylbuta-1,2-Dienyl)Phosphoryl)Oxymethane; Phosphonic Acid, (1,2-Butadienyl-3-Methyl), Dimethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13O3P |
| Molecular Weight | 176.15 |
| CAS Registry Number | 4037-12-1 |
| SMILES | CO[P](OC)(=O)[CH]=[C]=[C](C)C |
| InChI | 1S/C7H13O3P/c1-7(2)5-6-11(8,9-3)10-4/h6H,1-4H3 |
| InChIKey | NWKKSQUZYBRYCV-UHFFFAOYSA-N |
| Density | 1.018g/cm3 (Cal.) |
|---|---|
| Boiling point | 234.228°C at 760 mmHg (Cal.) |
| Flash point | 109.594°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1,2-Butadienyl-3-Methyl)-Phosphonic Acid Dimethyl Ester |