|
CAS#: 40452-18-4 Product: 9,10-Dihydro-beta-Methyl-2-Phenanthreneethanol No suppilers available for the product. |
| Name | 9,10-Dihydro-beta-Methyl-2-Phenanthreneethanol |
|---|---|
| Synonyms | 2-Phenanthreneethanol, 9,10-Dihydro-Beta-Methyl-; 9,10-Dihydro-Beta-Methyl-2-Phenanthreneethanol; Brn 1877846 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18O |
| Molecular Weight | 238.33 |
| CAS Registry Number | 40452-18-4 |
| SMILES | C1=C3C(=CC=C1C(CO)C)C2=C(C=CC=C2)CC3 |
| InChI | 1S/C17H18O/c1-12(11-18)14-8-9-17-15(10-14)7-6-13-4-2-3-5-16(13)17/h2-5,8-10,12,18H,6-7,11H2,1H3 |
| InChIKey | NJNXVQXOUUIOBZ-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.724°C at 760 mmHg (Cal.) |
| Flash point | 165.101°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,10-Dihydro-beta-Methyl-2-Phenanthreneethanol |