|
CAS#: 40505-21-3 Product: 6-Chloro-3-Acridinamine No suppilers available for the product. |
| Name | 6-Chloro-3-Acridinamine |
|---|---|
| Synonyms | 6-Chloro-3-Acridinamine; (6-Chloroacridin-3-Yl)Amine; 3-Acridinamine, 6-Chloro- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9ClN2 |
| Molecular Weight | 228.68 |
| CAS Registry Number | 40505-21-3 |
| SMILES | C3=CC2=CC1=CC=C(Cl)C=C1N=C2C=C3N |
| InChI | 1S/C13H9ClN2/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10/h1-7H,15H2 |
| InChIKey | OCESZSGMAAGZGO-UHFFFAOYSA-N |
| Density | 1.385g/cm3 (Cal.) |
|---|---|
| Boiling point | 455.975°C at 760 mmHg (Cal.) |
| Flash point | 229.565°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-3-Acridinamine |