|
CAS#: 40522-91-6 Product: Dimethyl-9H-Xanthene No suppilers available for the product. |
| Name | Dimethyl-9H-Xanthene |
|---|---|
| Synonyms | Dimethyl-9H-Xanthene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 |
| CAS Registry Number | 40522-91-6 |
| EINECS | 254-953-4 |
| SMILES | C1=CC(=C(C2=C1OC3=C(C2)C=CC=C3)C)C |
| InChI | 1S/C15H14O/c1-10-7-8-15-13(11(10)2)9-12-5-3-4-6-14(12)16-15/h3-8H,9H2,1-2H3 |
| InChIKey | PQPVYEDTTQIKIA-UHFFFAOYSA-N |
| Density | 1.109g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.751°C at 760 mmHg (Cal.) |
| Flash point | 164.146°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl-9H-Xanthene |