|
CAS#: 40581-96-2 Product: Sodium 2,3,6-Trichlorophenolate No suppilers available for the product. |
| Name | Sodium 2,3,6-Trichlorophenolate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H2Cl3NaO |
| Molecular Weight | 219.43 |
| CAS Registry Number | 40581-96-2 |
| EINECS | 254-981-7 |
| SMILES | C1=C(Cl)C(=C([O-])C(=C1)Cl)Cl.[Na+] |
| InChI | 1S/C6H3Cl3O.Na/c7-3-1-2-4(8)6(10)5(3)9;/h1-2,10H;/q;+1/p-1 |
| InChIKey | QPFGLNBLPQWZQB-UHFFFAOYSA-M |
| Boiling point | 230.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 93.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,3,6-Trichlorophenolate |