|
CAS#: 40615-35-8 Product: Bis(4-Methoxyphenyl)(Phenyl)Methanol No suppilers available for the product. |
| Name | Bis(4-Methoxyphenyl)(Phenyl)Methanol |
|---|---|
| Synonyms | 4,4'-dimethoxytrityl alcohol; 4,4'-dimethoxytritylalcohol |
| Molecular Structure | ![]() |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.38 |
| CAS Registry Number | 40615-35-8 |
| EINECS | 255-001-0 |
| SMILES | O(c1ccc(cc1)C(O)(c2ccccc2)c3ccc(OC)cc3)C |
| InChI | 1S/C21H20O3/c1-23-19-12-8-17(9-13-19)21(22,16-6-4-3-5-7-16)18-10-14-20(24-2)15-11-18/h3-15,22H,1-2H3 |
| InChIKey | XESTYUYENKNHHR-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.989°C at 760 mmHg (Cal.) |
| Flash point | 248.927°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(4-Methoxyphenyl)(Phenyl)Methanol |