|
CAS#: 40653-20-1 Product: 6-Deoxy-Manno-Heptopyranose No suppilers available for the product. |
| Name | 6-Deoxy-Manno-Heptopyranose |
|---|---|
| Synonyms | (2S,3S,4R,5R)-2,3,4,5,7-Pentahydroxyenanthaldehyde; 6-Deoxy-Manno-Heptopyranose; D-Manno-Heptose, 6-Deoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 194.18 |
| CAS Registry Number | 40653-20-1 |
| SMILES | [C@@H](CCO)([C@H]([C@@H]([C@@H](C=O)O)O)O)O |
| InChI | 1S/C7H14O6/c8-2-1-4(10)6(12)7(13)5(11)3-9/h3-8,10-13H,1-2H2/t4-,5-,6-,7-/m1/s1 |
| InChIKey | YTDXCLRWYXTNRN-DBRKOABJSA-N |
| Density | 1.489g/cm3 (Cal.) |
|---|---|
| Boiling point | 515.34°C at 760 mmHg (Cal.) |
| Flash point | 279.552°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Deoxy-Manno-Heptopyranose |