|
CAS#: 4071-39-0 Product: alpha-Allokainic Acid No suppilers available for the product. |
| Name | alpha-Allokainic Acid |
|---|---|
| Synonyms | (3S)-3-(Carboxymethyl)-4-Isopropenyl-Pyrrolidine-2-Carboxylic Acid; (3S)-3-(Carboxymethyl)-4-Isopropenyl-2-Pyrrolidinecarboxylic Acid; (3S)-3-(Carboxymethyl)-4-Isopropenyl-Proline |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 |
| CAS Registry Number | 4071-39-0 |
| SMILES | [C@H]1(CC(=O)O)C(C(C)=C)CNC1C(=O)O |
| InChI | 1S/C10H15NO4/c1-5(2)7-4-11-9(10(14)15)6(7)3-8(12)13/h6-7,9,11H,1,3-4H2,2H3,(H,12,13)(H,14,15)/t6-,7?,9?/m0/s1 |
| InChIKey | VLSMHEGGTFMBBZ-PTNSZRNDSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.879°C at 760 mmHg (Cal.) |
| Flash point | 219.831°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Allokainic Acid |