|
CAS#: 40737-73-3 Product: 1-(2-Methylphenyl)-4-(3-(2-thienyloxy)propyl)piperazine hydrochloride No suppilers available for the product. |
| Name | 1-(2-Methylphenyl)-4-(3-(2-thienyloxy)propyl)piperazine hydrochloride |
|---|---|
| Synonyms | 1-(O-Tolyl)-4-[3-(2-Thienyloxy)Propyl]Piperazine Hydrochloride; Hoe 510; Hoe-510 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H25ClN2OS |
| Molecular Weight | 352.92 |
| CAS Registry Number | 40737-73-3 |
| SMILES | [H+].C3=C(N1CCN(CC1)CCCOC2=CC=CS2)C(=CC=C3)C.[Cl-] |
| InChI | 1S/C18H24N2OS.ClH/c1-16-6-2-3-7-17(16)20-12-10-19(11-13-20)9-5-14-21-18-8-4-15-22-18;/h2-4,6-8,15H,5,9-14H2,1H3;1H |
| InChIKey | LHSALRSAMSISAT-UHFFFAOYSA-N |
| Boiling point | 468.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 237°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Methylphenyl)-4-(3-(2-thienyloxy)propyl)piperazine hydrochloride |