|
CAS#: 40824-36-0 Product: 1-(3,7,7-Trimethylbicyclo[4.1.0]Hept-3-En-2-Yl)Ethan-1-One No suppilers available for the product. |
| Name | 1-(3,7,7-Trimethylbicyclo[4.1.0]Hept-3-En-2-Yl)Ethan-1-One |
|---|---|
| Synonyms | 3-Carene, 2-Acetyl-; 1-(3,7,7-Trimethylbicyclo(4.1.0)Hept-3-En-2-Yl)Ethan-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 |
| CAS Registry Number | 40824-36-0 |
| EINECS | 255-095-3 |
| SMILES | CC1(C2C1CC=C(C2C(=O)C)C)C |
| InChI | 1S/C12H18O/c1-7-5-6-9-11(12(9,3)4)10(7)8(2)13/h5,9-11H,6H2,1-4H3 |
| InChIKey | XCBVDXSSPNIVAO-UHFFFAOYSA-N |
| Density | 0.958g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.225°C at 760 mmHg (Cal.) |
| Flash point | 89.707°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,7,7-Trimethylbicyclo[4.1.0]Hept-3-En-2-Yl)Ethan-1-One |