|
CAS#: 40843-84-3 Product: 4-(3-Methyl-1-Triazeno)Benzoic Acid, Potassium Salt No suppilers available for the product. |
| Name | 4-(3-Methyl-1-Triazeno)Benzoic Acid, Potassium Salt |
|---|---|
| Synonyms | Potassium 4-(N'-Methyliminohydrazino)Benzoate; P-(3-Methyl-1-Triazeno)Benzoic Acid, Potassium Salt; Ccris 2493 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H8KN3O2 |
| Molecular Weight | 217.27 |
| CAS Registry Number | 40843-84-3 |
| SMILES | C1=C(NN=NC)C=CC(=C1)C([O-])=O.[K+] |
| InChI | 1S/C8H9N3O2.K/c1-9-11-10-7-4-2-6(3-5-7)8(12)13;/h2-5H,1H3,(H,9,10)(H,12,13);/q;+1/p-1 |
| InChIKey | QYUZJCRYJAPXMP-UHFFFAOYSA-M |
| Boiling point | 320.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 147.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(3-Methyl-1-Triazeno)Benzoic Acid, Potassium Salt |