|
CAS#: 41035-89-6 Product: Dimethylamine Phosphate No suppilers available for the product. |
| Name | Dimethylamine Phosphate |
|---|---|
| Synonyms | Dimethylamine Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C2H7NO4P |
| Molecular Weight | 140.06 |
| CAS Registry Number | 41035-89-6 |
| EINECS | 255-184-7 |
| SMILES | O=[P]([O-])([O-])[O-].CNC |
| InChI | 1S/C2H7N.H3O4P/c1-3-2;1-5(2,3)4/h3H,1-2H3;(H3,1,2,3,4)/p-3 |
| InChIKey | XGTXYBOCSYLHCD-UHFFFAOYSA-K |
| Boiling point | 158°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 161.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethylamine Phosphate |