|
CAS#: 41139-95-1 Product: 2-[(4-Aminophenyl)Amino]Benzoic Acid No suppilers available for the product. |
| Name | 2-[(4-Aminophenyl)Amino]Benzoic Acid |
|---|---|
| Synonyms | Nsc170667 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.25 |
| CAS Registry Number | 41139-95-1 |
| SMILES | C1=CC(=CC=C1NC2=C(C(O)=O)C=CC=C2)N |
| InChI | 1S/C13H12N2O2/c14-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)13(16)17/h1-8,15H,14H2,(H,16,17) |
| InChIKey | UQBGXJCUJOULGZ-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 439.414°C at 760 mmHg (Cal.) |
| Flash point | 219.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Aminophenyl)Amino]Benzoic Acid |