Online Database of Chemicals from Around the World
| Name | 2,2',6,6'-Tetrachloro[1,1'-Biphenyl]-4,4'-Diol |
|---|---|
| Synonyms | 3,5-Dichloro-4-(2,6-Dichloro-4-Hydroxy-Phenyl)Phenol; (1,1'-Biphenyl)-4,4'-Diol, 2,2',6,6'-Tetrachloro-; Ai3-31286 |
| Molecular Structure | ![CAS#: 41363-16-0, 2,2',6,6'-Tetrachloro[1,1'-Biphenyl]-4,4'-Diol](/moreStructures/41363-16-0.gif) |
| Molecular Formula | C12H6Cl4O2 |
| Molecular Weight | 323.99 |
| CAS Registry Number | 41363-16-0 |
| SMILES | C1=C(O)C=C(C(=C1Cl)C2=C(C=C(C=C2Cl)O)Cl)Cl |
| InChI | 1S/C12H6Cl4O2/c13-7-1-5(17)2-8(14)11(7)12-9(15)3-6(18)4-10(12)16/h1-4,17-18H |
| InChIKey | CUBQDFRSSGBHPM-UHFFFAOYSA-N |
| Density | 1.625g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.755°C at 760 mmHg (Cal.) |
| Flash point | 185.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2',6,6'-Tetrachloro[1,1'-Biphenyl]-4,4'-Diol |
