|
CAS#: 41380-66-9 Product: Chloromethylpseudocumene No suppilers available for the product. |
| Name | Chloromethylpseudocumene |
|---|---|
| Synonyms | 2-(Chloromethyl)-1,3,4-Trimethyl-Benzene; Chloromethylpseudocumene; Monochloromethyl Pseudocumene |
| Molecular Structure | ![]() |
| Molecular Formula | C10H13Cl |
| Molecular Weight | 168.67 |
| CAS Registry Number | 41380-66-9 |
| SMILES | C1=C(C(=C(C(=C1)C)C)CCl)C |
| InChI | 1S/C10H13Cl/c1-7-4-5-8(2)10(6-11)9(7)3/h4-5H,6H2,1-3H3 |
| InChIKey | HGFIBEDXILACRG-UHFFFAOYSA-N |
| Density | 1.016g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.01°C at 760 mmHg (Cal.) |
| Flash point | 101.515°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chloromethylpseudocumene |