|
CAS#: 41392-09-0 Product: (Dimethylphosphinyl)Methyl Methacrylate No suppilers available for the product. |
| Name | (Dimethylphosphinyl)Methyl Methacrylate |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid Dimethylphosphorylmethyl Ester; 2-Methylacrylic Acid Dimethylphosphorylmethyl Ester; (Dimethylphosphinyl)Methyl Methacrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H13O3P |
| Molecular Weight | 176.15 |
| CAS Registry Number | 41392-09-0 |
| EINECS | 255-348-8 |
| SMILES | C([P](=O)(C)C)OC(=O)C(=C)C |
| InChI | 1S/C7H13O3P/c1-6(2)7(8)10-5-11(3,4)9/h1,5H2,2-4H3 |
| InChIKey | BAEVZTYQZQWKMM-UHFFFAOYSA-N |
| Density | 1.057g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.196°C at 760 mmHg (Cal.) |
| Flash point | 154.044°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Dimethylphosphinyl)Methyl Methacrylate |