|
CAS#: 41467-11-2 Product: (2Z)-3-Hydroxy-3-phenyl-2-propenedithioic acid No suppilers available for the product. |
| Name | (2Z)-3-Hydroxy-3-phenyl-2-propenedithioic acid |
|---|---|
| Synonyms | 1-Phenyl-3,3-Bis-Sulfanyl-Prop-2-En-1-One; 3,3-Dimercapto-1-Phenylprop-2-En-1-One; 3,3-Dimercapto-1-Phenyl-Prop-2-En-1-One |
| Molecular Structure | ![]() |
| Molecular Formula | C9H8OS2 |
| Molecular Weight | 196.28 |
| CAS Registry Number | 41467-11-2 |
| SMILES | C1=C(C(=O)C=C(S)S)C=CC=C1 |
| InChI | 1S/C9H8OS2/c10-8(6-9(11)12)7-4-2-1-3-5-7/h1-6,11-12H |
| InChIKey | GNACLQOGPJBGGQ-UHFFFAOYSA-N |
| Density | 1.235g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.302°C at 760 mmHg (Cal.) |
| Flash point | 134.209°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-3-Hydroxy-3-phenyl-2-propenedithioic acid |