Online Database of Chemicals from Around the World
|
CAS#: 41570-56-3 Product: 4-Ethoxy-N-Phenyl-o-Toluidine No suppilers available for the product. |
| Name | 4-Ethoxy-N-Phenyl-o-Toluidine |
|---|---|
| Synonyms | (4-Ethoxy-2-Methyl-Phenyl)-Phenyl-Amine; 4-Ethoxy-N-Phenyl-O-Toluidine; 4-Ethoxy-2-Methyl-N-Phenyl-Aniline |
| Molecular Structure |  |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 |
| CAS Registry Number | 41570-56-3 |
| EINECS | 255-442-9 |
| SMILES | C1=CC=C(C=C1)NC2=C(C=C(C=C2)OCC)C |
| InChI | 1S/C15H17NO/c1-3-17-14-9-10-15(12(2)11-14)16-13-7-5-4-6-8-13/h4-11,16H,3H2,1-2H3 |
| InChIKey | YGLYYWZISFBCPU-UHFFFAOYSA-N |
| Density | 1.071g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.655°C at 760 mmHg (Cal.) |
| Flash point | 147.901°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethoxy-N-Phenyl-o-Toluidine |