|
CAS#: 416899-88-2 Product: 5-Bromo-1-(4-Chlorobutyl)-1H-Indole-2,3-Dione No suppilers available for the product. |
| Name | 5-Bromo-1-(4-Chlorobutyl)-1H-Indole-2,3-Dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H11BrClNO2 |
| Molecular Weight | 316.58 |
| CAS Registry Number | 416899-88-2 |
| SMILES | Brc1cc2c(cc1)N(C(=O)C2=O)CCCCCl |
| InChI | 1S/C12H11BrClNO2/c13-8-3-4-10-9(7-8)11(16)12(17)15(10)6-2-1-5-14/h3-4,7H,1-2,5-6H2 |
| InChIKey | ZEALYRLWLVBYFO-UHFFFAOYSA-N |
| Density | 1.577g/cm3 (Cal.) |
|---|---|
| Boiling point | 446.034°C at 760 mmHg (Cal.) |
| Flash point | 223.554°C (Cal.) |
| Refractive index | 1.601 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Bromo-1-(4-Chlorobutyl)-1H-Indole-2,3-Dione |