|
CAS#: 41692-90-4 Product: 1-(Triphenylphosphoranylidene)Octan-2-One No suppilers available for the product. |
| Name | 1-(Triphenylphosphoranylidene)Octan-2-One |
|---|---|
| Synonyms | 1-(Triphenylphosphoranylidene)Octan-2-One |
| Molecular Structure | ![]() |
| Molecular Formula | C26H29OP |
| Molecular Weight | 388.49 |
| CAS Registry Number | 41692-90-4 |
| EINECS | 255-502-4 |
| SMILES | C3=C([P](C1=CC=CC=C1)(C2=CC=CC=C2)=CC(=O)CCCCCC)C=CC=C3 |
| InChI | 1S/C26H29OP/c1-2-3-4-8-15-23(27)22-28(24-16-9-5-10-17-24,25-18-11-6-12-19-25)26-20-13-7-14-21-26/h5-7,9-14,16-22H,2-4,8,15H2,1H3 |
| InChIKey | HENGQDHJJRVEDZ-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 533.848°C at 760 mmHg (Cal.) |
| Flash point | 276.661°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Triphenylphosphoranylidene)Octan-2-One |