|
CAS#: 41768-12-1 Product: 2,3,5,8-Tetrahydroxy-6-Methyl-1,4-Naphthalenedione No suppilers available for the product. |
| Name | 2,3,5,8-Tetrahydroxy-6-Methyl-1,4-Naphthalenedione |
|---|---|
| Synonyms | 5,6,7,8-Tetrahydroxy-2-Methyl-Naphthalene-1,4-Dione; 5,6,7,8-Tetrahydroxy-2-Methyl-1,4-Naphthoquinone; 1,4-Naphthalenedione, 2,3,5,8-Tetrahydroxy-6-Methyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8O6 |
| Molecular Weight | 236.18 |
| CAS Registry Number | 41768-12-1 |
| SMILES | CC2=CC(C1=C(C(=C(C(=C1O)O)O)O)C2=O)=O |
| InChI | 1S/C11H8O6/c1-3-2-4(12)5-6(7(3)13)9(15)11(17)10(16)8(5)14/h2,14-17H,1H3 |
| InChIKey | XATMXJYIXBGKBX-UHFFFAOYSA-N |
| Density | 1.759g/cm3 (Cal.) |
|---|---|
| Boiling point | 670.944°C at 760 mmHg (Cal.) |
| Flash point | 373.555°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,5,8-Tetrahydroxy-6-Methyl-1,4-Naphthalenedione |