|
CAS#: 41892-71-1 Product: Sodium 1-Ethyl Oxosuccinate No suppilers available for the product. |
| Name | Sodium 1-Ethyl Oxosuccinate |
|---|---|
| Synonyms | Sodium 4-Ethoxy-3,4-Dioxo-Butanoate; Sodium 4-Ethoxy-3,4-Diketo-Butyrate; Butanedioic Acid, Oxo-, Monoethyl Ester, Sodium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7NaO5 |
| Molecular Weight | 182.11 |
| CAS Registry Number | 41892-71-1 |
| EINECS | 255-581-5 |
| SMILES | C(C(=O)C(OCC)=O)C([O-])=O.[Na+] |
| InChI | 1S/C6H8O5.Na/c1-2-11-6(10)4(7)3-5(8)9;/h2-3H2,1H3,(H,8,9);/q;+1/p-1 |
| InChIKey | LNPFFSPJTLDKKL-UHFFFAOYSA-M |
| Boiling point | 295.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 124.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 1-Ethyl Oxosuccinate |