|
CAS#: 4198-93-0 Product: Trityl Hydroperoxide No suppilers available for the product. |
| Name | Trityl Hydroperoxide |
|---|---|
| Synonyms | Hydroperoxide, Triphenylmethyl; Nsc25440; Trityl Hydroperoxide |
| Molecular Structure | ![]() |
| Molecular Formula | C19H16O2 |
| Molecular Weight | 276.33 |
| CAS Registry Number | 4198-93-0 |
| SMILES | C3=C(C(OO)(C1=CC=CC=C1)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C19H16O2/c20-21-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,20H |
| InChIKey | ILNQBWPWHQSSNX-UHFFFAOYSA-N |
| Density | 1.168g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.625°C at 760 mmHg (Cal.) |
| Flash point | 227.54°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trityl Hydroperoxide |