|
CAS#: 4202-98-6 Product: 6-Chloro-9beta,10alpha-Pregna-4,6-Diene-3,20-Dione No suppilers available for the product. |
| Name | 6-Chloro-9beta,10alpha-Pregna-4,6-Diene-3,20-Dione |
|---|---|
| Synonyms | (8S,9S,10R,13S,14S,17S)-6-Chloro-17-Ethanoyl-10,13-Dimethyl-1,2,8,9,11,12,14,15,16,17-Decahydrocyclopenta[A]Phenanthren-3-One; 6-Chloro-9Beta,10Alpha-Pregna-4,6-Diene-3,20-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C21H27ClO2 |
| Molecular Weight | 346.90 |
| CAS Registry Number | 4202-98-6 |
| EINECS | 224-113-1 |
| SMILES | [C@H]24[C@H]1[C@@]([C@H](CC1)C(=O)C)(CC[C@@H]2[C@@]3(C(=CC(=O)CC3)C(=C4)Cl)C)C |
| InChI | 1S/C21H27ClO2/c1-12(23)15-4-5-16-14-11-19(22)18-10-13(24)6-8-21(18,3)17(14)7-9-20(15,16)2/h10-11,14-17H,4-9H2,1-3H3/t14-,15+,16-,17-,20+,21+/m0/s1 |
| InChIKey | HSPLPABFDZTFJB-HGUQNLGYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.03°C at 760 mmHg (Cal.) |
| Flash point | 197.978°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Chloro-9beta,10alpha-Pregna-4,6-Diene-3,20-Dione |