|
CAS#: 4204-23-3 Product: 4-Propionyl-1,2,6-Trimethylpiperazine No suppilers available for the product. |
| Name | 4-Propionyl-1,2,6-Trimethylpiperazine |
|---|---|
| Synonyms | 1-(3,4,5-Trimethyl-1-Piperazinyl)Propan-1-One; 4-Propionyl-1,2,6-Trimethylpiperazine; Piperazine, 1,2,6-Trimethyl-4-Propionyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 |
| CAS Registry Number | 4204-23-3 |
| SMILES | C(C(N1CC(N(C(C1)C)C)C)=O)C |
| InChI | 1S/C10H20N2O/c1-5-10(13)12-6-8(2)11(4)9(3)7-12/h8-9H,5-7H2,1-4H3 |
| InChIKey | HIVLUCCOZZYOEF-UHFFFAOYSA-N |
| Density | 0.939g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.933°C at 760 mmHg (Cal.) |
| Flash point | 106.755°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Propionyl-1,2,6-Trimethylpiperazine |