|
CAS#: 42021-23-8 Product: 2-(beta-(2-Quinolyl)ethyl)-1,2,3,4,6,7,12,12a-octahydropyrazino(2',1':6,1)pyrido(3,4-b)indole No suppilers available for the product. |
| Name | 2-(beta-(2-Quinolyl)ethyl)-1,2,3,4,6,7,12,12a-octahydropyrazino(2',1':6,1)pyrido(3,4-b)indole |
|---|---|
| Synonyms | Brn 0582013; Pyrazino(1',2':1,6)Pyrido(3,4-B)Indole, 1,2,3,4,6,7,12,12A-Octahydro-2-(2-(2-Quinolinyl)Ethyl)-, (+-)-; Quinethindole |
| Molecular Structure | ![]() |
| Molecular Formula | C25H26N4 |
| Molecular Weight | 382.51 |
| CAS Registry Number | 42021-23-8 |
| SMILES | C2=C1[NH]C6=C(C1=CC=C2)CC3N(CCN(C3)CCC5=NC4=CC=CC=C4C=C5)C6 |
| InChI | 1S/C25H26N4/c1-3-7-23-18(5-1)9-10-19(26-23)11-12-28-13-14-29-17-25-22(15-20(29)16-28)21-6-2-4-8-24(21)27-25/h1-10,20,27H,11-17H2 |
| InChIKey | NDPJSCSKAKGLKR-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 582.777°C at 760 mmHg (Cal.) |
| Flash point | 306.253°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(beta-(2-Quinolyl)ethyl)-1,2,3,4,6,7,12,12a-octahydropyrazino(2',1':6,1)pyrido(3,4-b)indole |