|
CAS#: 4204-99-3 Product: 1-Methyl-2-(4-Fluorophenyl)-5-Nitro-1H-Imidazole No suppilers available for the product. |
| Name | 1-Methyl-2-(4-Fluorophenyl)-5-Nitro-1H-Imidazole |
|---|---|
| Synonyms | 2-(4-Fluorophenyl)-1-Methyl-5-Nitro-Imidazole; 2-(4-Fluorophenyl)-1-Methyl-5-Nitro-1H-Imidazole; Mk 190 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8FN3O2 |
| Molecular Weight | 221.19 |
| CAS Registry Number | 4204-99-3 |
| SMILES | C1=C([N](C)C(=N1)C2=CC=C(C=C2)F)[N+]([O-])=O |
| InChI | 1S/C10H8FN3O2/c1-13-9(14(15)16)6-12-10(13)7-2-4-8(11)5-3-7/h2-6H,1H3 |
| InChIKey | AMRJVBTUDQHYID-UHFFFAOYSA-N |
| Density | 1.387g/cm3 (Cal.) |
|---|---|
| Boiling point | 389.766°C at 760 mmHg (Cal.) |
| Flash point | 189.524°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-2-(4-Fluorophenyl)-5-Nitro-1H-Imidazole |