Online Database of Chemicals from Around the World
|
CAS#: 42251-41-2 Product: 2-(Diethylamino)-4'-Fluoropropiophenone Hydrochloride No suppilers available for the product. |
| Name | 2-(Diethylamino)-4'-Fluoropropiophenone Hydrochloride |
|---|---|
| Synonyms | 2-(Diethylamino)-4'-Fluoropropiophenone Hydrochloride |
| Molecular Structure |  |
| Molecular Formula | C13H19ClFNO |
| Molecular Weight | 259.75 |
| CAS Registry Number | 42251-41-2 |
| EINECS | 255-737-2 |
| SMILES | [H+].C1=C(C(=O)C(N(CC)CC)C)C=CC(=C1)F.[Cl-] |
| InChI | 1S/C13H18FNO.ClH/c1-4-15(5-2)10(3)13(16)11-6-8-12(14)9-7-11;/h6-10H,4-5H2,1-3H3;1H |
| InChIKey | ATEZXBBQNHHPNV-UHFFFAOYSA-N |
| Boiling point | 302.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 136.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Diethylamino)-4'-Fluoropropiophenone Hydrochloride |